About methyl 3-[4-[3-[(2,4-difluorophenyl)sulfonyl-propylamino]propyl]phenyl]propanoate
methyl 3-[4-[3-[(2,4-difluorophenyl)sulfonyl-propylamino]propyl]phenyl]propanoate (PubChem CID 58713315) has the molecular formula C22H27F2NO4S
and a molecular weight of 439.52 g/mol. Its IUPAC name is methyl 3-[4-[3-[(2,4-difluorophenyl)sulfonyl-propylamino]propyl]phenyl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[4-[3-[(2,4-difluorophenyl)sulfonyl-propylamino]propyl]phenyl]propanoate |
| PubChem CID | 58713315 |
| Molecular Formula | C22H27F2NO4S |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | methyl 3-[4-[3-[(2,4-difluorophenyl)sulfonyl-propylamino]propyl]phenyl]propanoate |
| SMILES | CCCN(CCCc1ccc(CCC(=O)OC)cc1)S(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C22H27F2NO4S/c1-3-14-25(30(27,28)21-12-11-19(23)16-20(21)24)15-4-5-17-6-8-18(9-7-17)10-13-22(26)29-2/h6-9,11-12,16H,3-5,10,13-15H2,1-2H3 |
| InChIKey | OAVFPIKBEUBKSA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-[4-[3-[(2,4-difluorophenyl)sulfonyl-propylamino]propyl]phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[4-[3-[(2,4-difluorophenyl)sulfonyl-propylamino]propyl]phenyl]propanoate?
The IUPAC name of methyl 3-[4-[3-[(2,4-difluorophenyl)sulfonyl-propylamino]propyl]phenyl]propanoate (CID 58713315) is methyl 3-[4-[3-[(2,4-difluorophenyl)sulfonyl-propylamino]propyl]phenyl]propanoate.
What is the SMILES notation for methyl 3-[4-[3-[(2,4-difluorophenyl)sulfonyl-propylamino]propyl]phenyl]propanoate?
The canonical SMILES for methyl 3-[4-[3-[(2,4-difluorophenyl)sulfonyl-propylamino]propyl]phenyl]propanoate is CCCN(CCCc1ccc(CCC(=O)OC)cc1)S(=O)(=O)c1ccc(F)cc1F.
What is the InChIKey of methyl 3-[4-[3-[(2,4-difluorophenyl)sulfonyl-propylamino]propyl]phenyl]propanoate?
The InChIKey is OAVFPIKBEUBKSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27F2NO4S/c1-3-14-25(30(27,28)21-12-11-19(23)16-20(21)24)15-4-5-17-6-8-18(9-7-17)10-13-22(26)29-2/h6-9,11-12,16H,3-5,10,13-15H2,1-2H3.
What are the key properties of methyl 3-[4-[3-[(2,4-difluorophenyl)sulfonyl-propylamino]propyl]phenyl]propanoate?
methyl 3-[4-[3-[(2,4-difluorophenyl)sulfonyl-propylamino]propyl]phenyl]propanoate has a molecular weight of 439.52 g/mol, XLogP of 4.10, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[4-[3-[(2,4-difluorophenyl)sulfonyl-propylamino]propyl]phenyl]propanoate is sourced from PubChem (CID 58713315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).