C14H18N4O4 — CID 58713521
1-[2,5-diamino-6-(2,5-dioxopyrrol-1-yl)hexyl]pyrrole-2,5-dione (PubChem CID 58713521) has the molecular formula C14H18N4O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is 1-[2,5-diamino-6-(2,5-dioxopyrrol-1-yl)hexyl]pyrrole-2,5-dione.
| Compound Name | 1-[2,5-diamino-6-(2,5-dioxopyrrol-1-yl)hexyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 58713521 |
| Molecular Formula | C14H18N4O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 1-[2,5-diamino-6-(2,5-dioxopyrrol-1-yl)hexyl]pyrrole-2,5-dione |
| SMILES | NC(CCC(N)CN1C(=O)C=CC1=O)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C14H18N4O4/c15-9(7-17-11(19)3-4-12(17)20)1-2-10(16)8-18-13(21)5-6-14(18)22/h3-6,9-10H,1-2,7-8,15-16H2 |
| InChIKey | MEUUKSNYXCKOMK-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|