C17H22O3 — CID 58713735
(4R,4'aS,5R)-4,5-bis(ethenyl)-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydro-3H-naphthalene]-2'-one (PubChem CID 58713735) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is (4R,4'aS,5R)-4,5-bis(ethenyl)-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydro-3H-naphthalene]-2'-one.
| Compound Name | (4R,4'aS,5R)-4,5-bis(ethenyl)-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydro-3H-naphthalene]-2'-one |
|---|---|
| PubChem CID | 58713735 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (4R,4'aS,5R)-4,5-bis(ethenyl)-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydro-3H-naphthalene]-2'-one |
| SMILES | C=C[C@H]1OC2(CCCC3=CC(=O)CC[C@@]32C)O[C@@H]1C=C |
| InChI | InChI=1S/C17H22O3/c1-4-14-15(5-2)20-17(19-14)9-6-7-12-11-13(18)8-10-16(12,17)3/h4-5,11,14-15H,1-2,6-10H2,3H3/t14-,15-,16+/m1/s1 |
| InChIKey | QFEIWUIAOBFQLO-OAGGEKHMSA-N |
| XLogP | 3.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|