C18H22O4 — CID 58713761
(3'Z,4R,4'aS,5R)-4,5-bis(ethenyl)-3'-(hydroxymethylidene)-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydronaphthalene]-2'-one (PubChem CID 58713761) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is (3'Z,4R,4'aS,5R)-4,5-bis(ethenyl)-3'-(hydroxymethylidene)-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydronaphthalene]-2'-one.
| Compound Name | (3'Z,4R,4'aS,5R)-4,5-bis(ethenyl)-3'-(hydroxymethylidene)-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydronaphthalene]-2'-one |
|---|---|
| PubChem CID | 58713761 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (3'Z,4R,4'aS,5R)-4,5-bis(ethenyl)-3'-(hydroxymethylidene)-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydronaphthalene]-2'-one |
| SMILES | C=C[C@H]1OC2(CCCC3=CC(=O)/C(=C\O)C[C@@]32C)O[C@@H]1C=C |
| InChI | InChI=1S/C18H22O4/c1-4-15-16(5-2)22-18(21-15)8-6-7-13-9-14(20)12(11-19)10-17(13,18)3/h4-5,9,11,15-16,19H,1-2,6-8,10H2,3H3/b12-11-/t15-,16-,17+/m1/s1 |
| InChIKey | JWFINERUAJHNIX-HQUKFDPUSA-N |
| XLogP | 3.37 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|