About (5R)-5,6-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridine
(5R)-5,6-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridine (PubChem CID 58714676) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is (5R)-5,6-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridine.
Molecular Properties
| Compound Name | (5R)-5,6-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridine |
| PubChem CID | 58714676 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | (5R)-5,6-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridine |
| SMILES | CC1Cc2ncccc2[C@@H]1C |
| InChI | InChI=1S/C10H13N/c1-7-6-10-9(8(7)2)4-3-5-11-10/h3-5,7-8H,6H2,1-2H3/t7?,8-/m1/s1 |
| InChIKey | ZIDIOJKCSLFYES-BRFYHDHCSA-N |
| XLogP | 2.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5R)-5,6-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5,6-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridine?
The IUPAC name of (5R)-5,6-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridine (CID 58714676) is (5R)-5,6-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridine.
What is the SMILES notation for (5R)-5,6-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridine?
The canonical SMILES for (5R)-5,6-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridine is CC1Cc2ncccc2[C@@H]1C.
What is the InChIKey of (5R)-5,6-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridine?
The InChIKey is ZIDIOJKCSLFYES-BRFYHDHCSA-N. The full InChI is InChI=1S/C10H13N/c1-7-6-10-9(8(7)2)4-3-5-11-10/h3-5,7-8H,6H2,1-2H3/t7?,8-/m1/s1.
What are the key properties of (5R)-5,6-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridine?
(5R)-5,6-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridine has a molecular weight of 147.22 g/mol, XLogP of 2.38, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5,6-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridine is sourced from PubChem (CID 58714676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).