About (3S,4S)-3,4-dimethyl-1-methylsulfonylpiperidine
(3S,4S)-3,4-dimethyl-1-methylsulfonylpiperidine (PubChem CID 58714705) has the molecular formula C8H17NO2S
and a molecular weight of 191.30 g/mol. Its IUPAC name is (3S,4S)-3,4-dimethyl-1-methylsulfonylpiperidine.
Molecular Properties
| Compound Name | (3S,4S)-3,4-dimethyl-1-methylsulfonylpiperidine |
| PubChem CID | 58714705 |
| Molecular Formula | C8H17NO2S |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.10 |
| IUPAC Name | (3S,4S)-3,4-dimethyl-1-methylsulfonylpiperidine |
| SMILES | C[C@@H]1CN(S(C)(=O)=O)CC[C@@H]1C |
| InChI | InChI=1S/C8H17NO2S/c1-7-4-5-9(6-8(7)2)12(3,10)11/h7-8H,4-6H2,1-3H3/t7-,8+/m0/s1 |
| InChIKey | RXVTXANRWGIPJW-JGVFFNPUSA-N |
| XLogP | 0.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S,4S)-3,4-dimethyl-1-methylsulfonylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-3,4-dimethyl-1-methylsulfonylpiperidine?
The IUPAC name of (3S,4S)-3,4-dimethyl-1-methylsulfonylpiperidine (CID 58714705) is (3S,4S)-3,4-dimethyl-1-methylsulfonylpiperidine.
What is the SMILES notation for (3S,4S)-3,4-dimethyl-1-methylsulfonylpiperidine?
The canonical SMILES for (3S,4S)-3,4-dimethyl-1-methylsulfonylpiperidine is C[C@@H]1CN(S(C)(=O)=O)CC[C@@H]1C.
What is the InChIKey of (3S,4S)-3,4-dimethyl-1-methylsulfonylpiperidine?
The InChIKey is RXVTXANRWGIPJW-JGVFFNPUSA-N. The full InChI is InChI=1S/C8H17NO2S/c1-7-4-5-9(6-8(7)2)12(3,10)11/h7-8H,4-6H2,1-3H3/t7-,8+/m0/s1.
What are the key properties of (3S,4S)-3,4-dimethyl-1-methylsulfonylpiperidine?
(3S,4S)-3,4-dimethyl-1-methylsulfonylpiperidine has a molecular weight of 191.30 g/mol, XLogP of 0.92, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-3,4-dimethyl-1-methylsulfonylpiperidine is sourced from PubChem (CID 58714705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).