C19H30O3Si — CID 58714750
(7E,9Z)-6-[tert-butyl(dimethyl)silyl]oxy-1-oxacyclotetradeca-7,9-dien-3-yn-2-one (PubChem CID 58714750) has the molecular formula C19H30O3Si and a molecular weight of 334.53 g/mol. Its IUPAC name is (7E,9Z)-6-[tert-butyl(dimethyl)silyl]oxy-1-oxacyclotetradeca-7,9-dien-3-yn-2-one.
| Compound Name | (7E,9Z)-6-[tert-butyl(dimethyl)silyl]oxy-1-oxacyclotetradeca-7,9-dien-3-yn-2-one |
|---|---|
| PubChem CID | 58714750 |
| Molecular Formula | C19H30O3Si |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | (7E,9Z)-6-[tert-butyl(dimethyl)silyl]oxy-1-oxacyclotetradeca-7,9-dien-3-yn-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1/C=C/C=C\CCCCOC(=O)C#CC1 |
| InChI | InChI=1S/C19H30O3Si/c1-19(2,3)23(4,5)22-17-13-10-8-6-7-9-11-16-21-18(20)15-12-14-17/h6,8,10,13,17H,7,9,11,14,16H2,1-5H3/b8-6-,13-10+ |
| InChIKey | BBBXSTPACGUREF-WLPHGBIISA-N |
| XLogP | 4.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|