C7H14NO2P — CID 58714916
(3R,5R)-3-methyl-5-[(1S)-1-(phosphanylamino)ethyl]oxolan-2-one (PubChem CID 58714916) has the molecular formula C7H14NO2P and a molecular weight of 175.17 g/mol. Its IUPAC name is (3R,5R)-3-methyl-5-[(1S)-1-(phosphanylamino)ethyl]oxolan-2-one.
| Compound Name | (3R,5R)-3-methyl-5-[(1S)-1-(phosphanylamino)ethyl]oxolan-2-one |
|---|---|
| PubChem CID | 58714916 |
| Molecular Formula | C7H14NO2P |
| Molecular Weight | 175.17 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | (3R,5R)-3-methyl-5-[(1S)-1-(phosphanylamino)ethyl]oxolan-2-one |
| SMILES | C[C@@H]1C[C@H]([C@H](C)NP)OC1=O |
| InChI | InChI=1S/C7H14NO2P/c1-4-3-6(5(2)8-11)10-7(4)9/h4-6,8H,3,11H2,1-2H3/t4-,5+,6-/m1/s1 |
| InChIKey | RVFFVRPFXZIRSM-NGJCXOISSA-N |
| XLogP | 0.71 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.17 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|