About benzyl 6-[(3,4-dimethylbenzoyl)amino]-2-(4-phenylmethoxyphenyl)hex-2-enoate
benzyl 6-[(3,4-dimethylbenzoyl)amino]-2-(4-phenylmethoxyphenyl)hex-2-enoate (PubChem CID 58714958) has the molecular formula C35H35NO4
and a molecular weight of 533.67 g/mol. Its IUPAC name is benzyl 6-[(3,4-dimethylbenzoyl)amino]-2-(4-phenylmethoxyphenyl)hex-2-enoate.
Molecular Properties
| Compound Name | benzyl 6-[(3,4-dimethylbenzoyl)amino]-2-(4-phenylmethoxyphenyl)hex-2-enoate |
| PubChem CID | 58714958 |
| Molecular Formula | C35H35NO4 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | benzyl 6-[(3,4-dimethylbenzoyl)amino]-2-(4-phenylmethoxyphenyl)hex-2-enoate |
| SMILES | Cc1ccc(C(=O)NCCCC=C(C(=O)OCc2ccccc2)c2ccc(OCc3ccccc3)cc2)cc1C |
| InChI | InChI=1S/C35H35NO4/c1-26-16-17-31(23-27(26)2)34(37)36-22-10-9-15-33(35(38)40-25-29-13-7-4-8-14-29)30-18-20-32(21-19-30)39-24-28-11-5-3-6-12-28/h3-8,11-21,23H,9-10,22,24-25H2,1-2H3,(H,36,37) |
| InChIKey | CEISRKBTAUSXCP-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze benzyl 6-[(3,4-dimethylbenzoyl)amino]-2-(4-phenylmethoxyphenyl)hex-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 6-[(3,4-dimethylbenzoyl)amino]-2-(4-phenylmethoxyphenyl)hex-2-enoate?
The IUPAC name of benzyl 6-[(3,4-dimethylbenzoyl)amino]-2-(4-phenylmethoxyphenyl)hex-2-enoate (CID 58714958) is benzyl 6-[(3,4-dimethylbenzoyl)amino]-2-(4-phenylmethoxyphenyl)hex-2-enoate.
What is the SMILES notation for benzyl 6-[(3,4-dimethylbenzoyl)amino]-2-(4-phenylmethoxyphenyl)hex-2-enoate?
The canonical SMILES for benzyl 6-[(3,4-dimethylbenzoyl)amino]-2-(4-phenylmethoxyphenyl)hex-2-enoate is Cc1ccc(C(=O)NCCCC=C(C(=O)OCc2ccccc2)c2ccc(OCc3ccccc3)cc2)cc1C.
What is the InChIKey of benzyl 6-[(3,4-dimethylbenzoyl)amino]-2-(4-phenylmethoxyphenyl)hex-2-enoate?
The InChIKey is CEISRKBTAUSXCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H35NO4/c1-26-16-17-31(23-27(26)2)34(37)36-22-10-9-15-33(35(38)40-25-29-13-7-4-8-14-29)30-18-20-32(21-19-30)39-24-28-11-5-3-6-12-28/h3-8,11-21,23H,9-10,22,24-25H2,1-2H3,(H,36,37).
What are the key properties of benzyl 6-[(3,4-dimethylbenzoyl)amino]-2-(4-phenylmethoxyphenyl)hex-2-enoate?
benzyl 6-[(3,4-dimethylbenzoyl)amino]-2-(4-phenylmethoxyphenyl)hex-2-enoate has a molecular weight of 533.67 g/mol, XLogP of 7.22, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 6-[(3,4-dimethylbenzoyl)amino]-2-(4-phenylmethoxyphenyl)hex-2-enoate is sourced from PubChem (CID 58714958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).