C23H24Br2N2O6S4+2 — CID 58715185
5-bromo-2-[[5-bromo-3-(4-sulfobutyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]spiro[1,3-benzothiazol-3-ium-3,1'-azolidin-1-ium]-2'-sulfonic acid (PubChem CID 58715185) has the molecular formula C23H24Br2N2O6S4+2 and a molecular weight of 712.53 g/mol. Its IUPAC name is 5-bromo-2-[[5-bromo-3-(4-sulfobutyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]spiro[1,3-benzothiazol-3-ium-3,1'-azolidin-1-ium]-2'-sulfonic acid.
| Compound Name | 5-bromo-2-[[5-bromo-3-(4-sulfobutyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]spiro[1,3-benzothiazol-3-ium-3,1'-azolidin-1-ium]-2'-sulfonic acid |
|---|---|
| PubChem CID | 58715185 |
| Molecular Formula | C23H24Br2N2O6S4+2 |
| Molecular Weight | 712.53 g/mol |
| Exact Mass | 709.89 |
| IUPAC Name | 5-bromo-2-[[5-bromo-3-(4-sulfobutyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]spiro[1,3-benzothiazol-3-ium-3,1'-azolidin-1-ium]-2'-sulfonic acid |
| SMILES | O=S(=O)(O)CCCC[n+]1c(C=C2Sc3ccc(Br)cc3[N+]23CCCC3S(=O)(=O)O)sc2ccc(Br)cc21 |
| InChI | InChI=1S/C23H22Br2N2O6S4/c24-15-5-7-19-17(12-15)26(9-1-2-11-36(28,29)30)21(34-19)14-22-27(10-3-4-23(27)37(31,32)33)18-13-16(25)6-8-20(18)35-22/h5-8,12-14,23H,1-4,9-11H2/p+2 |
| InChIKey | PDLQERSKWSMFGT-UHFFFAOYSA-P |
| XLogP | 5.80 |
| TPSA | 112.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.53 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|