C32H43N3O4 — CID 58715402
(3S)-1-butyl-3-(cyclohexylmethyl)-9-oxido-9-[(4-phenoxyphenyl)methyl]-1,4-diaza-9-azoniaspiro[5.5]undecane-2,5-dione (PubChem CID 58715402) has the molecular formula C32H43N3O4 and a molecular weight of 533.71 g/mol. Its IUPAC name is (3S)-1-butyl-3-(cyclohexylmethyl)-9-oxido-9-[(4-phenoxyphenyl)methyl]-1,4-diaza-9-azoniaspiro[5.5]undecane-2,5-dione.
| Compound Name | (3S)-1-butyl-3-(cyclohexylmethyl)-9-oxido-9-[(4-phenoxyphenyl)methyl]-1,4-diaza-9-azoniaspiro[5.5]undecane-2,5-dione |
|---|---|
| PubChem CID | 58715402 |
| Molecular Formula | C32H43N3O4 |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 533.33 |
| IUPAC Name | (3S)-1-butyl-3-(cyclohexylmethyl)-9-oxido-9-[(4-phenoxyphenyl)methyl]-1,4-diaza-9-azoniaspiro[5.5]undecane-2,5-dione |
| SMILES | CCCCN1C(=O)[C@H](CC2CCCCC2)NC(=O)C12CC[N+]([O-])(Cc1ccc(Oc3ccccc3)cc1)CC2 |
| InChI | InChI=1S/C32H43N3O4/c1-2-3-20-34-30(36)29(23-25-10-6-4-7-11-25)33-31(37)32(34)18-21-35(38,22-19-32)24-26-14-16-28(17-15-26)39-27-12-8-5-9-13-27/h5,8-9,12-17,25,29H,2-4,6-7,10-11,18-24H2,1H3,(H,33,37)/t29-,32?,35?/m0/s1 |
| InChIKey | TURODGFMGIUBLK-STPVNRCPSA-N |
| XLogP | 5.92 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|