C31H43F2N5O2 — CID 58715411
(3S)-1-butyl-3-(cyclohexylmethyl)-9-[[1-(2,4-difluorophenyl)-3,5-dimethylpyrazol-4-yl]methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione (PubChem CID 58715411) has the molecular formula C31H43F2N5O2 and a molecular weight of 555.71 g/mol. Its IUPAC name is (3S)-1-butyl-3-(cyclohexylmethyl)-9-[[1-(2,4-difluorophenyl)-3,5-dimethylpyrazol-4-yl]methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione.
| Compound Name | (3S)-1-butyl-3-(cyclohexylmethyl)-9-[[1-(2,4-difluorophenyl)-3,5-dimethylpyrazol-4-yl]methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione |
|---|---|
| PubChem CID | 58715411 |
| Molecular Formula | C31H43F2N5O2 |
| Molecular Weight | 555.71 g/mol |
| Exact Mass | 555.34 |
| IUPAC Name | (3S)-1-butyl-3-(cyclohexylmethyl)-9-[[1-(2,4-difluorophenyl)-3,5-dimethylpyrazol-4-yl]methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione |
| SMILES | CCCCN1C(=O)[C@H](CC2CCCCC2)NC(=O)C12CCN(Cc1c(C)nn(-c3ccc(F)cc3F)c1C)CC2 |
| InChI | InChI=1S/C31H43F2N5O2/c1-4-5-15-37-29(39)27(18-23-9-7-6-8-10-23)34-30(40)31(37)13-16-36(17-14-31)20-25-21(2)35-38(22(25)3)28-12-11-24(32)19-26(28)33/h11-12,19,23,27H,4-10,13-18,20H2,1-3H3,(H,34,40)/t27-/m0/s1 |
| InChIKey | DDYJWJFBJDFZKK-MHZLTWQESA-N |
| XLogP | 5.20 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.71 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |