C17H28O4 — CID 58715591
methyl (1'R,4'aR,8'aS)-1',4'a,8'a-trimethylspiro[1,3-dioxolane-2,5'-2,3,4,6,7,8-hexahydronaphthalene]-1'-carboxylate (PubChem CID 58715591) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is methyl (1'R,4'aR,8'aS)-1',4'a,8'a-trimethylspiro[1,3-dioxolane-2,5'-2,3,4,6,7,8-hexahydronaphthalene]-1'-carboxylate.
| Compound Name | methyl (1'R,4'aR,8'aS)-1',4'a,8'a-trimethylspiro[1,3-dioxolane-2,5'-2,3,4,6,7,8-hexahydronaphthalene]-1'-carboxylate |
|---|---|
| PubChem CID | 58715591 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | methyl (1'R,4'aR,8'aS)-1',4'a,8'a-trimethylspiro[1,3-dioxolane-2,5'-2,3,4,6,7,8-hexahydronaphthalene]-1'-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@@]2(C)C3(CCC[C@]12C)OCCO3 |
| InChI | InChI=1S/C17H28O4/c1-14(13(18)19-4)7-5-9-16(3)15(14,2)8-6-10-17(16)20-11-12-21-17/h5-12H2,1-4H3/t14-,15+,16+/m0/s1 |
| InChIKey | WQRJPQAAAWWZOG-ARFHVFGLSA-N |
| XLogP | 3.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |