C27H32ClNO8 — CID 58715627
[(7R)-7-acetamido-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-4-yl]methyl 4-chlorobutanoate (PubChem CID 58715627) has the molecular formula C27H32ClNO8 and a molecular weight of 534.01 g/mol. Its IUPAC name is [(7R)-7-acetamido-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-4-yl]methyl 4-chlorobutanoate.
| Compound Name | [(7R)-7-acetamido-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-4-yl]methyl 4-chlorobutanoate |
|---|---|
| PubChem CID | 58715627 |
| Molecular Formula | C27H32ClNO8 |
| Molecular Weight | 534.01 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | [(7R)-7-acetamido-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-4-yl]methyl 4-chlorobutanoate |
| SMILES | COc1c(COC(=O)CCCCl)c2c(c(OC)c1OC)-c1ccc(OC)c(=O)cc1[C@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C27H32ClNO8/c1-15(30)29-20-10-8-17-19(14-37-23(32)7-6-12-28)25(34-3)27(36-5)26(35-4)24(17)16-9-11-22(33-2)21(31)13-18(16)20/h9,11,13,20H,6-8,10,12,14H2,1-5H3,(H,29,30)/t20-/m1/s1 |
| InChIKey | GSCXSXCAXJJJFU-HXUWFJFHSA-N |
| XLogP | 3.93 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.01 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|