About 1-methoxypyrrole-2,5-diimine
1-methoxypyrrole-2,5-diimine (PubChem CID 58715707) has the molecular formula C5H7N3O
and a molecular weight of 125.13 g/mol. Its IUPAC name is 1-methoxypyrrole-2,5-diimine.
Molecular Properties
| Compound Name | 1-methoxypyrrole-2,5-diimine |
| PubChem CID | 58715707 |
| Molecular Formula | C5H7N3O |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.06 |
| IUPAC Name | 1-methoxypyrrole-2,5-diimine |
| SMILES | [H]/N=C1\C=C/C(=N\[H])N1OC |
| InChI | InChI=1S/C5H7N3O/c1-9-8-4(6)2-3-5(8)7/h2-3,6-7H,1H3/b6-4+,7-5+ |
| InChIKey | OHXBUIHWGNTNKO-YDFGWWAZSA-N |
| XLogP | 0.37 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxypyrrole-2,5-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypyrrole-2,5-diimine?
The IUPAC name of 1-methoxypyrrole-2,5-diimine (CID 58715707) is 1-methoxypyrrole-2,5-diimine.
What is the SMILES notation for 1-methoxypyrrole-2,5-diimine?
The canonical SMILES for 1-methoxypyrrole-2,5-diimine is [H]/N=C1\C=C/C(=N\[H])N1OC.
What is the InChIKey of 1-methoxypyrrole-2,5-diimine?
The InChIKey is OHXBUIHWGNTNKO-YDFGWWAZSA-N. The full InChI is InChI=1S/C5H7N3O/c1-9-8-4(6)2-3-5(8)7/h2-3,6-7H,1H3/b6-4+,7-5+.
What are the key properties of 1-methoxypyrrole-2,5-diimine?
1-methoxypyrrole-2,5-diimine has a molecular weight of 125.13 g/mol, XLogP of 0.37, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypyrrole-2,5-diimine is sourced from PubChem (CID 58715707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).