C21H34O8 — CID 58716018
3-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 1-O,5-O-diethyl cyclohexane-1,3,5-tricarboxylate (PubChem CID 58716018) has the molecular formula C21H34O8 and a molecular weight of 414.50 g/mol. Its IUPAC name is 3-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 1-O,5-O-diethyl cyclohexane-1,3,5-tricarboxylate.
| Compound Name | 3-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 1-O,5-O-diethyl cyclohexane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 58716018 |
| Molecular Formula | C21H34O8 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 3-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 1-O,5-O-diethyl cyclohexane-1,3,5-tricarboxylate |
| SMILES | CCOC(=O)C1CC(C(=O)OCC)CC(C(=O)OCCOC(=O)C(C)(C)CC)C1 |
| InChI | InChI=1S/C21H34O8/c1-6-21(4,5)20(25)29-10-9-28-19(24)16-12-14(17(22)26-7-2)11-15(13-16)18(23)27-8-3/h14-16H,6-13H2,1-5H3 |
| InChIKey | ZKJFRODRJGRXFN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|