C8H10F8N2 — CID 58716088
1,4-diethyl-2,2,3,3,5,5,6,6-octafluoropiperazine (PubChem CID 58716088) has the molecular formula C8H10F8N2 and a molecular weight of 286.17 g/mol. Its IUPAC name is 1,4-diethyl-2,2,3,3,5,5,6,6-octafluoropiperazine.
| Compound Name | 1,4-diethyl-2,2,3,3,5,5,6,6-octafluoropiperazine |
|---|---|
| PubChem CID | 58716088 |
| Molecular Formula | C8H10F8N2 |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 1,4-diethyl-2,2,3,3,5,5,6,6-octafluoropiperazine |
| SMILES | CCN1C(F)(F)C(F)(F)N(CC)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8H10F8N2/c1-3-17-5(9,10)7(13,14)18(4-2)8(15,16)6(17,11)12/h3-4H2,1-2H3 |
| InChIKey | AKDDBXFHDDIPTM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|