C29H20N6Na2O6S2 — CID 58716222
disodium;6-[[4-anilino-6-[(6-oxidoperoxysulfanylnaphthalen-2-yl)amino]-1,3,5-triazin-2-yl]amino]naphthalene-2-sulfonate (PubChem CID 58716222) has the molecular formula C29H20N6Na2O6S2 and a molecular weight of 658.63 g/mol. Its IUPAC name is disodium;6-[[4-anilino-6-[(6-oxidoperoxysulfanylnaphthalen-2-yl)amino]-1,3,5-triazin-2-yl]amino]naphthalene-2-sulfonate.
| Compound Name | disodium;6-[[4-anilino-6-[(6-oxidoperoxysulfanylnaphthalen-2-yl)amino]-1,3,5-triazin-2-yl]amino]naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 58716222 |
| Molecular Formula | C29H20N6Na2O6S2 |
| Molecular Weight | 658.63 g/mol |
| Exact Mass | 658.07 |
| IUPAC Name | disodium;6-[[4-anilino-6-[(6-oxidoperoxysulfanylnaphthalen-2-yl)amino]-1,3,5-triazin-2-yl]amino]naphthalene-2-sulfonate |
| SMILES | O=S(=O)([O-])c1ccc2cc(Nc3nc(Nc4ccccc4)nc(Nc4ccc5cc(SOO[O-])ccc5c4)n3)ccc2c1.[Na+].[Na+] |
| InChI | InChI=1S/C29H22N6O6S2.2Na/c36-40-41-42-25-12-8-18-14-23(10-6-20(18)16-25)31-28-33-27(30-22-4-2-1-3-5-22)34-29(35-28)32-24-11-7-21-17-26(43(37,38)39)13-9-19(21)15-24;;/h1-17,36H,(H,37,38,39)(H3,30,31,32,33,34,35);;/q;2*+1/p-2 |
| InChIKey | HQCMZLONTIDCDJ-UHFFFAOYSA-L |
| XLogP | -0.45 |
| TPSA | 173.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.63 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|