About (6-propan-2-yloxan-2-yl) 6-propan-2-yloxane-2-carboxylate
(6-propan-2-yloxan-2-yl) 6-propan-2-yloxane-2-carboxylate (PubChem CID 58716311) has the molecular formula C17H30O4
and a molecular weight of 298.42 g/mol. Its IUPAC name is (6-propan-2-yloxan-2-yl) 6-propan-2-yloxane-2-carboxylate.
Molecular Properties
| Compound Name | (6-propan-2-yloxan-2-yl) 6-propan-2-yloxane-2-carboxylate |
| PubChem CID | 58716311 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | (6-propan-2-yloxan-2-yl) 6-propan-2-yloxane-2-carboxylate |
| SMILES | CC(C)C1CCCC(OC(=O)C2CCCC(C(C)C)O2)O1 |
| InChI | InChI=1S/C17H30O4/c1-11(2)13-7-5-9-15(19-13)17(18)21-16-10-6-8-14(20-16)12(3)4/h11-16H,5-10H2,1-4H3 |
| InChIKey | DROUCEMIZCVJGM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-propan-2-yloxan-2-yl) 6-propan-2-yloxane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-propan-2-yloxan-2-yl) 6-propan-2-yloxane-2-carboxylate?
The IUPAC name of (6-propan-2-yloxan-2-yl) 6-propan-2-yloxane-2-carboxylate (CID 58716311) is (6-propan-2-yloxan-2-yl) 6-propan-2-yloxane-2-carboxylate.
What is the SMILES notation for (6-propan-2-yloxan-2-yl) 6-propan-2-yloxane-2-carboxylate?
The canonical SMILES for (6-propan-2-yloxan-2-yl) 6-propan-2-yloxane-2-carboxylate is CC(C)C1CCCC(OC(=O)C2CCCC(C(C)C)O2)O1.
What is the InChIKey of (6-propan-2-yloxan-2-yl) 6-propan-2-yloxane-2-carboxylate?
The InChIKey is DROUCEMIZCVJGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O4/c1-11(2)13-7-5-9-15(19-13)17(18)21-16-10-6-8-14(20-16)12(3)4/h11-16H,5-10H2,1-4H3.
What are the key properties of (6-propan-2-yloxan-2-yl) 6-propan-2-yloxane-2-carboxylate?
(6-propan-2-yloxan-2-yl) 6-propan-2-yloxane-2-carboxylate has a molecular weight of 298.42 g/mol, XLogP of 3.67, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-propan-2-yloxan-2-yl) 6-propan-2-yloxane-2-carboxylate is sourced from PubChem (CID 58716311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).