About 3-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]sulfanylpropanal
3-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]sulfanylpropanal (PubChem CID 58716572) has the molecular formula C13H16O3S
and a molecular weight of 252.33 g/mol. Its IUPAC name is 3-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]sulfanylpropanal.
Molecular Properties
| Compound Name | 3-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]sulfanylpropanal |
| PubChem CID | 58716572 |
| Molecular Formula | C13H16O3S |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 3-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]sulfanylpropanal |
| SMILES | CC1(c2ccc(SCCC=O)cc2)OCCO1 |
| InChI | InChI=1S/C13H16O3S/c1-13(15-8-9-16-13)11-3-5-12(6-4-11)17-10-2-7-14/h3-7H,2,8-10H2,1H3 |
| InChIKey | TXUCZIWXDFYAMS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]sulfanylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]sulfanylpropanal?
The IUPAC name of 3-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]sulfanylpropanal (CID 58716572) is 3-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]sulfanylpropanal.
What is the SMILES notation for 3-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]sulfanylpropanal?
The canonical SMILES for 3-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]sulfanylpropanal is CC1(c2ccc(SCCC=O)cc2)OCCO1.
What is the InChIKey of 3-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]sulfanylpropanal?
The InChIKey is TXUCZIWXDFYAMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O3S/c1-13(15-8-9-16-13)11-3-5-12(6-4-11)17-10-2-7-14/h3-7H,2,8-10H2,1H3.
What are the key properties of 3-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]sulfanylpropanal?
3-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]sulfanylpropanal has a molecular weight of 252.33 g/mol, XLogP of 2.59, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]sulfanylpropanal is sourced from PubChem (CID 58716572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).