About [4-(2-methyl-5,6-dihydro-4H-pyrimidin-1-yl)phenyl]methylphosphane
[4-(2-methyl-5,6-dihydro-4H-pyrimidin-1-yl)phenyl]methylphosphane (PubChem CID 58717196) has the molecular formula C12H17N2P
and a molecular weight of 220.26 g/mol. Its IUPAC name is [4-(2-methyl-5,6-dihydro-4H-pyrimidin-1-yl)phenyl]methylphosphane.
Molecular Properties
| Compound Name | [4-(2-methyl-5,6-dihydro-4H-pyrimidin-1-yl)phenyl]methylphosphane |
| PubChem CID | 58717196 |
| Molecular Formula | C12H17N2P |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | [4-(2-methyl-5,6-dihydro-4H-pyrimidin-1-yl)phenyl]methylphosphane |
| SMILES | CC1=NCCCN1c1ccc(CP)cc1 |
| InChI | InChI=1S/C12H17N2P/c1-10-13-7-2-8-14(10)12-5-3-11(9-15)4-6-12/h3-6H,2,7-9,15H2,1H3 |
| InChIKey | UDGNCSGDDHPCFV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-methyl-5,6-dihydro-4H-pyrimidin-1-yl)phenyl]methylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-methyl-5,6-dihydro-4H-pyrimidin-1-yl)phenyl]methylphosphane?
The IUPAC name of [4-(2-methyl-5,6-dihydro-4H-pyrimidin-1-yl)phenyl]methylphosphane (CID 58717196) is [4-(2-methyl-5,6-dihydro-4H-pyrimidin-1-yl)phenyl]methylphosphane.
What is the SMILES notation for [4-(2-methyl-5,6-dihydro-4H-pyrimidin-1-yl)phenyl]methylphosphane?
The canonical SMILES for [4-(2-methyl-5,6-dihydro-4H-pyrimidin-1-yl)phenyl]methylphosphane is CC1=NCCCN1c1ccc(CP)cc1.
What is the InChIKey of [4-(2-methyl-5,6-dihydro-4H-pyrimidin-1-yl)phenyl]methylphosphane?
The InChIKey is UDGNCSGDDHPCFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N2P/c1-10-13-7-2-8-14(10)12-5-3-11(9-15)4-6-12/h3-6H,2,7-9,15H2,1H3.
What are the key properties of [4-(2-methyl-5,6-dihydro-4H-pyrimidin-1-yl)phenyl]methylphosphane?
[4-(2-methyl-5,6-dihydro-4H-pyrimidin-1-yl)phenyl]methylphosphane has a molecular weight of 220.26 g/mol, XLogP of 2.69, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-methyl-5,6-dihydro-4H-pyrimidin-1-yl)phenyl]methylphosphane is sourced from PubChem (CID 58717196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).