About 2-methoxy-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine
2-methoxy-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine (PubChem CID 58717200) has the molecular formula C12H22N2O
and a molecular weight of 210.32 g/mol. Its IUPAC name is 2-methoxy-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine.
Molecular Properties
| Compound Name | 2-methoxy-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine |
| PubChem CID | 58717200 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 2-methoxy-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine |
| SMILES | COC1=NCCCN1C1CCC(C)CC1 |
| InChI | InChI=1S/C12H22N2O/c1-10-4-6-11(7-5-10)14-9-3-8-13-12(14)15-2/h10-11H,3-9H2,1-2H3 |
| InChIKey | UQRIAJJQVGEBKK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxy-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine?
The IUPAC name of 2-methoxy-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine (CID 58717200) is 2-methoxy-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine.
What is the SMILES notation for 2-methoxy-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine?
The canonical SMILES for 2-methoxy-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine is COC1=NCCCN1C1CCC(C)CC1.
What is the InChIKey of 2-methoxy-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine?
The InChIKey is UQRIAJJQVGEBKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O/c1-10-4-6-11(7-5-10)14-9-3-8-13-12(14)15-2/h10-11H,3-9H2,1-2H3.
What are the key properties of 2-methoxy-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine?
2-methoxy-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine has a molecular weight of 210.32 g/mol, XLogP of 2.27, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine is sourced from PubChem (CID 58717200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).