About (Z)-3-methyl-5-(4-methylsulfonylphenyl)-N-piperidin-1-yl-1,3,4-thiadiazol-2-imine
(Z)-3-methyl-5-(4-methylsulfonylphenyl)-N-piperidin-1-yl-1,3,4-thiadiazol-2-imine (PubChem CID 58717408) has the molecular formula C15H20N4O2S2
and a molecular weight of 352.49 g/mol. Its IUPAC name is (Z)-3-methyl-5-(4-methylsulfonylphenyl)-N-piperidin-1-yl-1,3,4-thiadiazol-2-imine.
Molecular Properties
| Compound Name | (Z)-3-methyl-5-(4-methylsulfonylphenyl)-N-piperidin-1-yl-1,3,4-thiadiazol-2-imine |
| PubChem CID | 58717408 |
| Molecular Formula | C15H20N4O2S2 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | (Z)-3-methyl-5-(4-methylsulfonylphenyl)-N-piperidin-1-yl-1,3,4-thiadiazol-2-imine |
| SMILES | Cn1nc(-c2ccc(S(C)(=O)=O)cc2)s/c1=N\N1CCCCC1 |
| InChI | InChI=1S/C15H20N4O2S2/c1-18-15(17-19-10-4-3-5-11-19)22-14(16-18)12-6-8-13(9-7-12)23(2,20)21/h6-9H,3-5,10-11H2,1-2H3/b17-15- |
| InChIKey | OHHDITZEYZDDJF-ICFOKQHNSA-N |
| XLogP | 1.85 |
| TPSA | 67.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (Z)-3-methyl-5-(4-methylsulfonylphenyl)-N-piperidin-1-yl-1,3,4-thiadiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-methyl-5-(4-methylsulfonylphenyl)-N-piperidin-1-yl-1,3,4-thiadiazol-2-imine?
The IUPAC name of (Z)-3-methyl-5-(4-methylsulfonylphenyl)-N-piperidin-1-yl-1,3,4-thiadiazol-2-imine (CID 58717408) is (Z)-3-methyl-5-(4-methylsulfonylphenyl)-N-piperidin-1-yl-1,3,4-thiadiazol-2-imine.
What is the SMILES notation for (Z)-3-methyl-5-(4-methylsulfonylphenyl)-N-piperidin-1-yl-1,3,4-thiadiazol-2-imine?
The canonical SMILES for (Z)-3-methyl-5-(4-methylsulfonylphenyl)-N-piperidin-1-yl-1,3,4-thiadiazol-2-imine is Cn1nc(-c2ccc(S(C)(=O)=O)cc2)s/c1=N\N1CCCCC1.
What is the InChIKey of (Z)-3-methyl-5-(4-methylsulfonylphenyl)-N-piperidin-1-yl-1,3,4-thiadiazol-2-imine?
The InChIKey is OHHDITZEYZDDJF-ICFOKQHNSA-N. The full InChI is InChI=1S/C15H20N4O2S2/c1-18-15(17-19-10-4-3-5-11-19)22-14(16-18)12-6-8-13(9-7-12)23(2,20)21/h6-9H,3-5,10-11H2,1-2H3/b17-15-.
What are the key properties of (Z)-3-methyl-5-(4-methylsulfonylphenyl)-N-piperidin-1-yl-1,3,4-thiadiazol-2-imine?
(Z)-3-methyl-5-(4-methylsulfonylphenyl)-N-piperidin-1-yl-1,3,4-thiadiazol-2-imine has a molecular weight of 352.49 g/mol, XLogP of 1.85, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-methyl-5-(4-methylsulfonylphenyl)-N-piperidin-1-yl-1,3,4-thiadiazol-2-imine is sourced from PubChem (CID 58717408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).