C10H15NO — CID 58718244
(8aS)-2-ethylidene-1,3,5,6,8,8a-hexahydroindolizin-7-one (PubChem CID 58718244) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (8aS)-2-ethylidene-1,3,5,6,8,8a-hexahydroindolizin-7-one.
| Compound Name | (8aS)-2-ethylidene-1,3,5,6,8,8a-hexahydroindolizin-7-one |
|---|---|
| PubChem CID | 58718244 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (8aS)-2-ethylidene-1,3,5,6,8,8a-hexahydroindolizin-7-one |
| SMILES | CC=C1C[C@H]2CC(=O)CCN2C1 |
| InChI | InChI=1S/C10H15NO/c1-2-8-5-9-6-10(12)3-4-11(9)7-8/h2,9H,3-7H2,1H3/t9-/m0/s1 |
| InChIKey | ABHWMLRKOIOPCQ-VIFPVBQESA-N |
| XLogP | 1.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|