C25H25F6NO2 — CID 58718512
(E)-N-[(2S)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpent-4-en-2-yl]but-2-enamide (PubChem CID 58718512) has the molecular formula C25H25F6NO2 and a molecular weight of 485.47 g/mol. Its IUPAC name is (E)-N-[(2S)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpent-4-en-2-yl]but-2-enamide.
| Compound Name | (E)-N-[(2S)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpent-4-en-2-yl]but-2-enamide |
|---|---|
| PubChem CID | 58718512 |
| Molecular Formula | C25H25F6NO2 |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | (E)-N-[(2S)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpent-4-en-2-yl]but-2-enamide |
| SMILES | C=CC[C@](CO[C@H](C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)(NC(=O)/C=C/C)c1ccccc1 |
| InChI | InChI=1S/C25H25F6NO2/c1-4-9-22(33)32-23(12-5-2,19-10-7-6-8-11-19)16-34-17(3)18-13-20(24(26,27)28)15-21(14-18)25(29,30)31/h4-11,13-15,17H,2,12,16H2,1,3H3,(H,32,33)/b9-4+/t17-,23-/m1/s1 |
| InChIKey | XMYPUAWCGMGTST-WKUWCUSISA-N |
| XLogP | 6.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|