C24H21F6NO4 — CID 58718527
ethyl (5S)-5-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-2-oxo-5-phenyl-1H-pyrrole-3-carboxylate (PubChem CID 58718527) has the molecular formula C24H21F6NO4 and a molecular weight of 501.42 g/mol. Its IUPAC name is ethyl (5S)-5-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-2-oxo-5-phenyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl (5S)-5-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-2-oxo-5-phenyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 58718527 |
| Molecular Formula | C24H21F6NO4 |
| Molecular Weight | 501.42 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | ethyl (5S)-5-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-2-oxo-5-phenyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C[C@@](CO[C@H](C)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2ccccc2)NC1=O |
| InChI | InChI=1S/C24H21F6NO4/c1-3-34-21(33)19-12-22(31-20(19)32,16-7-5-4-6-8-16)13-35-14(2)15-9-17(23(25,26)27)11-18(10-15)24(28,29)30/h4-12,14H,3,13H2,1-2H3,(H,31,32)/t14-,22-/m1/s1 |
| InChIKey | DNTHUXIKNHFAFK-JLCFBVMHSA-N |
| XLogP | 5.32 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.42 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|