About ethyl 2-[2-oxo-4-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]butanoate
ethyl 2-[2-oxo-4-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]butanoate (PubChem CID 58718588) has the molecular formula C12H18F3NO3
and a molecular weight of 281.27 g/mol. Its IUPAC name is ethyl 2-[2-oxo-4-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]butanoate.
Molecular Properties
| Compound Name | ethyl 2-[2-oxo-4-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]butanoate |
| PubChem CID | 58718588 |
| Molecular Formula | C12H18F3NO3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | ethyl 2-[2-oxo-4-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]butanoate |
| SMILES | CCOC(=O)C(CC)N1CC(CC(F)(F)F)CC1=O |
| InChI | InChI=1S/C12H18F3NO3/c1-3-9(11(18)19-4-2)16-7-8(5-10(16)17)6-12(13,14)15/h8-9H,3-7H2,1-2H3 |
| InChIKey | PRCWKNPBSIKNGH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-[2-oxo-4-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-oxo-4-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]butanoate?
The IUPAC name of ethyl 2-[2-oxo-4-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]butanoate (CID 58718588) is ethyl 2-[2-oxo-4-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]butanoate.
What is the SMILES notation for ethyl 2-[2-oxo-4-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]butanoate?
The canonical SMILES for ethyl 2-[2-oxo-4-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]butanoate is CCOC(=O)C(CC)N1CC(CC(F)(F)F)CC1=O.
What is the InChIKey of ethyl 2-[2-oxo-4-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]butanoate?
The InChIKey is PRCWKNPBSIKNGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F3NO3/c1-3-9(11(18)19-4-2)16-7-8(5-10(16)17)6-12(13,14)15/h8-9H,3-7H2,1-2H3.
What are the key properties of ethyl 2-[2-oxo-4-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]butanoate?
ethyl 2-[2-oxo-4-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]butanoate has a molecular weight of 281.27 g/mol, XLogP of 2.13, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-oxo-4-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]butanoate is sourced from PubChem (CID 58718588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).