About 3-[2-(chloromethyl)-1,3-dioxolan-4-yl]-5-methyl-1,2-dihydropyrimidin-6-one
3-[2-(chloromethyl)-1,3-dioxolan-4-yl]-5-methyl-1,2-dihydropyrimidin-6-one (PubChem CID 58718637) has the molecular formula C9H13ClN2O3
and a molecular weight of 232.67 g/mol. Its IUPAC name is 3-[2-(chloromethyl)-1,3-dioxolan-4-yl]-5-methyl-1,2-dihydropyrimidin-6-one.
Molecular Properties
| Compound Name | 3-[2-(chloromethyl)-1,3-dioxolan-4-yl]-5-methyl-1,2-dihydropyrimidin-6-one |
| PubChem CID | 58718637 |
| Molecular Formula | C9H13ClN2O3 |
| Molecular Weight | 232.67 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 3-[2-(chloromethyl)-1,3-dioxolan-4-yl]-5-methyl-1,2-dihydropyrimidin-6-one |
| SMILES | CC1=CN(C2COC(CCl)O2)CNC1=O |
| InChI | InChI=1S/C9H13ClN2O3/c1-6-3-12(5-11-9(6)13)7-4-14-8(2-10)15-7/h3,7-8H,2,4-5H2,1H3,(H,11,13) |
| InChIKey | PFQMJXPEWKLION-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.67 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(chloromethyl)-1,3-dioxolan-4-yl]-5-methyl-1,2-dihydropyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(chloromethyl)-1,3-dioxolan-4-yl]-5-methyl-1,2-dihydropyrimidin-6-one?
The IUPAC name of 3-[2-(chloromethyl)-1,3-dioxolan-4-yl]-5-methyl-1,2-dihydropyrimidin-6-one (CID 58718637) is 3-[2-(chloromethyl)-1,3-dioxolan-4-yl]-5-methyl-1,2-dihydropyrimidin-6-one.
What is the SMILES notation for 3-[2-(chloromethyl)-1,3-dioxolan-4-yl]-5-methyl-1,2-dihydropyrimidin-6-one?
The canonical SMILES for 3-[2-(chloromethyl)-1,3-dioxolan-4-yl]-5-methyl-1,2-dihydropyrimidin-6-one is CC1=CN(C2COC(CCl)O2)CNC1=O.
What is the InChIKey of 3-[2-(chloromethyl)-1,3-dioxolan-4-yl]-5-methyl-1,2-dihydropyrimidin-6-one?
The InChIKey is PFQMJXPEWKLION-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClN2O3/c1-6-3-12(5-11-9(6)13)7-4-14-8(2-10)15-7/h3,7-8H,2,4-5H2,1H3,(H,11,13).
What are the key properties of 3-[2-(chloromethyl)-1,3-dioxolan-4-yl]-5-methyl-1,2-dihydropyrimidin-6-one?
3-[2-(chloromethyl)-1,3-dioxolan-4-yl]-5-methyl-1,2-dihydropyrimidin-6-one has a molecular weight of 232.67 g/mol, XLogP of 0.22, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(chloromethyl)-1,3-dioxolan-4-yl]-5-methyl-1,2-dihydropyrimidin-6-one is sourced from PubChem (CID 58718637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).