C16H30S — CID 58719040
2-(butylsulfanylmethyl)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 58719040) has the molecular formula C16H30S and a molecular weight of 254.48 g/mol. Its IUPAC name is 2-(butylsulfanylmethyl)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-(butylsulfanylmethyl)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 58719040 |
| Molecular Formula | C16H30S |
| Molecular Weight | 254.48 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | 2-(butylsulfanylmethyl)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCCSCC1CCC2CC(C)CCC2C1 |
| InChI | InChI=1S/C16H30S/c1-3-4-9-17-12-14-6-8-15-10-13(2)5-7-16(15)11-14/h13-16H,3-12H2,1-2H3 |
| InChIKey | FMMDWHRQXOMFRL-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.48 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|