About 3-tert-butyl-6-(2,2-dimethylpropyl)-1-oxa-2-azaspiro[4.5]dec-2-ene
3-tert-butyl-6-(2,2-dimethylpropyl)-1-oxa-2-azaspiro[4.5]dec-2-ene (PubChem CID 58719601) has the molecular formula C17H31NO
and a molecular weight of 265.44 g/mol. Its IUPAC name is 3-tert-butyl-6-(2,2-dimethylpropyl)-1-oxa-2-azaspiro[4.5]dec-2-ene.
Molecular Properties
| Compound Name | 3-tert-butyl-6-(2,2-dimethylpropyl)-1-oxa-2-azaspiro[4.5]dec-2-ene |
| PubChem CID | 58719601 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | 3-tert-butyl-6-(2,2-dimethylpropyl)-1-oxa-2-azaspiro[4.5]dec-2-ene |
| SMILES | CC(C)(C)CC1CCCCC12CC(C(C)(C)C)=NO2 |
| InChI | InChI=1S/C17H31NO/c1-15(2,3)11-13-9-7-8-10-17(13)12-14(18-19-17)16(4,5)6/h13H,7-12H2,1-6H3 |
| InChIKey | ZVUMJMDDLHRVGM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-tert-butyl-6-(2,2-dimethylpropyl)-1-oxa-2-azaspiro[4.5]dec-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-6-(2,2-dimethylpropyl)-1-oxa-2-azaspiro[4.5]dec-2-ene?
The IUPAC name of 3-tert-butyl-6-(2,2-dimethylpropyl)-1-oxa-2-azaspiro[4.5]dec-2-ene (CID 58719601) is 3-tert-butyl-6-(2,2-dimethylpropyl)-1-oxa-2-azaspiro[4.5]dec-2-ene.
What is the SMILES notation for 3-tert-butyl-6-(2,2-dimethylpropyl)-1-oxa-2-azaspiro[4.5]dec-2-ene?
The canonical SMILES for 3-tert-butyl-6-(2,2-dimethylpropyl)-1-oxa-2-azaspiro[4.5]dec-2-ene is CC(C)(C)CC1CCCCC12CC(C(C)(C)C)=NO2.
What is the InChIKey of 3-tert-butyl-6-(2,2-dimethylpropyl)-1-oxa-2-azaspiro[4.5]dec-2-ene?
The InChIKey is ZVUMJMDDLHRVGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31NO/c1-15(2,3)11-13-9-7-8-10-17(13)12-14(18-19-17)16(4,5)6/h13H,7-12H2,1-6H3.
What are the key properties of 3-tert-butyl-6-(2,2-dimethylpropyl)-1-oxa-2-azaspiro[4.5]dec-2-ene?
3-tert-butyl-6-(2,2-dimethylpropyl)-1-oxa-2-azaspiro[4.5]dec-2-ene has a molecular weight of 265.44 g/mol, XLogP of 5.17, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-6-(2,2-dimethylpropyl)-1-oxa-2-azaspiro[4.5]dec-2-ene is sourced from PubChem (CID 58719601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).