C41H40N4O3Si — CID 58719726
3-(1-benzylpyrrol-3-yl)-4-[1-[3-[tert-butyl(diphenyl)silyl]oxypropyl]pyrrolo[2,3-b]pyridin-3-yl]pyrrole-2,5-dione (PubChem CID 58719726) has the molecular formula C41H40N4O3Si and a molecular weight of 664.88 g/mol. Its IUPAC name is 3-(1-benzylpyrrol-3-yl)-4-[1-[3-[tert-butyl(diphenyl)silyl]oxypropyl]pyrrolo[2,3-b]pyridin-3-yl]pyrrole-2,5-dione.
| Compound Name | 3-(1-benzylpyrrol-3-yl)-4-[1-[3-[tert-butyl(diphenyl)silyl]oxypropyl]pyrrolo[2,3-b]pyridin-3-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 58719726 |
| Molecular Formula | C41H40N4O3Si |
| Molecular Weight | 664.88 g/mol |
| Exact Mass | 664.29 |
| IUPAC Name | 3-(1-benzylpyrrol-3-yl)-4-[1-[3-[tert-butyl(diphenyl)silyl]oxypropyl]pyrrolo[2,3-b]pyridin-3-yl]pyrrole-2,5-dione |
| SMILES | CC(C)(C)[Si](OCCCn1cc(C2=C(c3ccn(Cc4ccccc4)c3)C(=O)NC2=O)c2cccnc21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H40N4O3Si/c1-41(2,3)49(32-17-9-5-10-18-32,33-19-11-6-12-20-33)48-26-14-24-45-29-35(34-21-13-23-42-38(34)45)37-36(39(46)43-40(37)47)31-22-25-44(28-31)27-30-15-7-4-8-16-30/h4-13,15-23,25,28-29H,14,24,26-27H2,1-3H3,(H,43,46,47) |
| InChIKey | SJWDWHUWFKKFBN-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.88 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|