C37H39N5O3Si — CID 58719728
3-[1-[3-[tert-butyl(diphenyl)silyl]oxypropyl]pyrrolo[2,3-b]pyridin-3-yl]-4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl)pyrrole-2,5-dione (PubChem CID 58719728) has the molecular formula C37H39N5O3Si and a molecular weight of 629.84 g/mol. Its IUPAC name is 3-[1-[3-[tert-butyl(diphenyl)silyl]oxypropyl]pyrrolo[2,3-b]pyridin-3-yl]-4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-[3-[tert-butyl(diphenyl)silyl]oxypropyl]pyrrolo[2,3-b]pyridin-3-yl]-4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 58719728 |
| Molecular Formula | C37H39N5O3Si |
| Molecular Weight | 629.84 g/mol |
| Exact Mass | 629.28 |
| IUPAC Name | 3-[1-[3-[tert-butyl(diphenyl)silyl]oxypropyl]pyrrolo[2,3-b]pyridin-3-yl]-4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl)pyrrole-2,5-dione |
| SMILES | CC(C)(C)[Si](OCCCn1cc(C2=C(c3cc4n(n3)CCCC4)C(=O)NC2=O)c2cccnc21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H39N5O3Si/c1-37(2,3)46(27-15-6-4-7-16-27,28-17-8-5-9-18-28)45-23-13-21-41-25-30(29-19-12-20-38-34(29)41)32-33(36(44)39-35(32)43)31-24-26-14-10-11-22-42(26)40-31/h4-9,12,15-20,24-25H,10-11,13-14,21-23H2,1-3H3,(H,39,43,44) |
| InChIKey | QYXLXZKNRARVLA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.84 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|