C43H54N4O3Si2 — CID 58719736
3-[1-[3-[tert-butyl(diphenyl)silyl]oxypropyl]pyrrolo[2,3-b]pyridin-3-yl]-4-[1-tri(propan-2-yl)silylpyrrol-3-yl]pyrrole-2,5-dione (PubChem CID 58719736) has the molecular formula C43H54N4O3Si2 and a molecular weight of 731.10 g/mol. Its IUPAC name is 3-[1-[3-[tert-butyl(diphenyl)silyl]oxypropyl]pyrrolo[2,3-b]pyridin-3-yl]-4-[1-tri(propan-2-yl)silylpyrrol-3-yl]pyrrole-2,5-dione.
| Compound Name | 3-[1-[3-[tert-butyl(diphenyl)silyl]oxypropyl]pyrrolo[2,3-b]pyridin-3-yl]-4-[1-tri(propan-2-yl)silylpyrrol-3-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 58719736 |
| Molecular Formula | C43H54N4O3Si2 |
| Molecular Weight | 731.10 g/mol |
| Exact Mass | 730.37 |
| IUPAC Name | 3-[1-[3-[tert-butyl(diphenyl)silyl]oxypropyl]pyrrolo[2,3-b]pyridin-3-yl]-4-[1-tri(propan-2-yl)silylpyrrol-3-yl]pyrrole-2,5-dione |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1ccc(C2=C(c3cn(CCCO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)c4ncccc34)C(=O)NC2=O)c1 |
| InChI | InChI=1S/C43H54N4O3Si2/c1-30(2)51(31(3)4,32(5)6)47-26-23-33(28-47)38-39(42(49)45-41(38)48)37-29-46(40-36(37)22-16-24-44-40)25-17-27-50-52(43(7,8)9,34-18-12-10-13-19-34)35-20-14-11-15-21-35/h10-16,18-24,26,28-32H,17,25,27H2,1-9H3,(H,45,48,49) |
| InChIKey | IGQBXTINYRFAQZ-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.10 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|