About tributyl-(2,4-dimethoxypyrimidin-5-yl)stannane
tributyl-(2,4-dimethoxypyrimidin-5-yl)stannane (PubChem CID 58719737) has the molecular formula C18H34N2O2Sn
and a molecular weight of 429.19 g/mol. Its IUPAC name is tributyl-(2,4-dimethoxypyrimidin-5-yl)stannane.
Molecular Properties
| Compound Name | tributyl-(2,4-dimethoxypyrimidin-5-yl)stannane |
| PubChem CID | 58719737 |
| Molecular Formula | C18H34N2O2Sn |
| Molecular Weight | 429.19 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | tributyl-(2,4-dimethoxypyrimidin-5-yl)stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cnc(OC)nc1OC |
| InChI | InChI=1S/C6H7N2O2.3C4H9.Sn/c1-9-5-3-4-7-6(8-5)10-2;3*1-3-4-2;/h4H,1-2H3;3*1,3-4H2,2H3; |
| InChIKey | BUNICSJJYKSRMW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.19 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tributyl-(2,4-dimethoxypyrimidin-5-yl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-(2,4-dimethoxypyrimidin-5-yl)stannane?
The IUPAC name of tributyl-(2,4-dimethoxypyrimidin-5-yl)stannane (CID 58719737) is tributyl-(2,4-dimethoxypyrimidin-5-yl)stannane.
What is the SMILES notation for tributyl-(2,4-dimethoxypyrimidin-5-yl)stannane?
The canonical SMILES for tributyl-(2,4-dimethoxypyrimidin-5-yl)stannane is CCCC[Sn](CCCC)(CCCC)c1cnc(OC)nc1OC.
What is the InChIKey of tributyl-(2,4-dimethoxypyrimidin-5-yl)stannane?
The InChIKey is BUNICSJJYKSRMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N2O2.3C4H9.Sn/c1-9-5-3-4-7-6(8-5)10-2;3*1-3-4-2;/h4H,1-2H3;3*1,3-4H2,2H3;.
What are the key properties of tributyl-(2,4-dimethoxypyrimidin-5-yl)stannane?
tributyl-(2,4-dimethoxypyrimidin-5-yl)stannane has a molecular weight of 429.19 g/mol, XLogP of 4.55, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-(2,4-dimethoxypyrimidin-5-yl)stannane is sourced from PubChem (CID 58719737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).