C24H31N5O3Si — CID 58719743
3-[1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]pyrrolo[2,3-b]pyridin-3-yl]-4-(1-methylpyrazol-3-yl)pyrrole-2,5-dione (PubChem CID 58719743) has the molecular formula C24H31N5O3Si and a molecular weight of 465.63 g/mol. Its IUPAC name is 3-[1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]pyrrolo[2,3-b]pyridin-3-yl]-4-(1-methylpyrazol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]pyrrolo[2,3-b]pyridin-3-yl]-4-(1-methylpyrazol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 58719743 |
| Molecular Formula | C24H31N5O3Si |
| Molecular Weight | 465.63 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 3-[1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]pyrrolo[2,3-b]pyridin-3-yl]-4-(1-methylpyrazol-3-yl)pyrrole-2,5-dione |
| SMILES | Cn1ccc(C2=C(c3cn(CCCO[Si](C)(C)C(C)(C)C)c4ncccc34)C(=O)NC2=O)n1 |
| InChI | InChI=1S/C24H31N5O3Si/c1-24(2,3)33(5,6)32-14-8-12-29-15-17(16-9-7-11-25-21(16)29)19-20(23(31)26-22(19)30)18-10-13-28(4)27-18/h7,9-11,13,15H,8,12,14H2,1-6H3,(H,26,30,31) |
| InChIKey | BCNRLEXBEPPADM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.63 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|