C35H36N4O3Si — CID 58719756
3-[1-[3-[tert-butyl(diphenyl)silyl]oxypropyl]pyrrolo[2,3-b]pyridin-3-yl]-4-(1-methylpyrrol-3-yl)pyrrole-2,5-dione (PubChem CID 58719756) has the molecular formula C35H36N4O3Si and a molecular weight of 588.78 g/mol. Its IUPAC name is 3-[1-[3-[tert-butyl(diphenyl)silyl]oxypropyl]pyrrolo[2,3-b]pyridin-3-yl]-4-(1-methylpyrrol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-[3-[tert-butyl(diphenyl)silyl]oxypropyl]pyrrolo[2,3-b]pyridin-3-yl]-4-(1-methylpyrrol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 58719756 |
| Molecular Formula | C35H36N4O3Si |
| Molecular Weight | 588.78 g/mol |
| Exact Mass | 588.26 |
| IUPAC Name | 3-[1-[3-[tert-butyl(diphenyl)silyl]oxypropyl]pyrrolo[2,3-b]pyridin-3-yl]-4-(1-methylpyrrol-3-yl)pyrrole-2,5-dione |
| SMILES | Cn1ccc(C2=C(c3cn(CCCO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)c4ncccc34)C(=O)NC2=O)c1 |
| InChI | InChI=1S/C35H36N4O3Si/c1-35(2,3)43(26-13-7-5-8-14-26,27-15-9-6-10-16-27)42-22-12-20-39-24-29(28-17-11-19-36-32(28)39)31-30(33(40)37-34(31)41)25-18-21-38(4)23-25/h5-11,13-19,21,23-24H,12,20,22H2,1-4H3,(H,37,40,41) |
| InChIKey | NIILZZBSDPYNKR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.78 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|