C36H37N5O3Si — CID 58719773
3-[1-[3-[tert-butyl(diphenyl)silyl]oxypropyl]pyrrolo[2,3-b]pyridin-3-yl]-4-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)pyrrole-2,5-dione (PubChem CID 58719773) has the molecular formula C36H37N5O3Si and a molecular weight of 615.81 g/mol. Its IUPAC name is 3-[1-[3-[tert-butyl(diphenyl)silyl]oxypropyl]pyrrolo[2,3-b]pyridin-3-yl]-4-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-[3-[tert-butyl(diphenyl)silyl]oxypropyl]pyrrolo[2,3-b]pyridin-3-yl]-4-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 58719773 |
| Molecular Formula | C36H37N5O3Si |
| Molecular Weight | 615.81 g/mol |
| Exact Mass | 615.27 |
| IUPAC Name | 3-[1-[3-[tert-butyl(diphenyl)silyl]oxypropyl]pyrrolo[2,3-b]pyridin-3-yl]-4-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)pyrrole-2,5-dione |
| SMILES | CC(C)(C)[Si](OCCCn1cc(C2=C(c3cc4n(n3)CCC4)C(=O)NC2=O)c2cccnc21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H37N5O3Si/c1-36(2,3)45(26-14-6-4-7-15-26,27-16-8-5-9-17-27)44-22-12-20-40-24-29(28-18-10-19-37-33(28)40)31-32(35(43)38-34(31)42)30-23-25-13-11-21-41(25)39-30/h4-10,14-19,23-24H,11-13,20-22H2,1-3H3,(H,38,42,43) |
| InChIKey | KJEFDEDMSDVVJQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.81 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|