C28H32FN3O3Si — CID 58719775
3-[1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]pyrrolo[2,3-b]pyridin-3-yl]-4-[(E)-2-(4-fluorophenyl)ethenyl]pyrrole-2,5-dione (PubChem CID 58719775) has the molecular formula C28H32FN3O3Si and a molecular weight of 505.67 g/mol. Its IUPAC name is 3-[1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]pyrrolo[2,3-b]pyridin-3-yl]-4-[(E)-2-(4-fluorophenyl)ethenyl]pyrrole-2,5-dione.
| Compound Name | 3-[1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]pyrrolo[2,3-b]pyridin-3-yl]-4-[(E)-2-(4-fluorophenyl)ethenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 58719775 |
| Molecular Formula | C28H32FN3O3Si |
| Molecular Weight | 505.67 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 3-[1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]pyrrolo[2,3-b]pyridin-3-yl]-4-[(E)-2-(4-fluorophenyl)ethenyl]pyrrole-2,5-dione |
| SMILES | CC(C)(C)[Si](C)(C)OCCCn1cc(C2=C(/C=C/c3ccc(F)cc3)C(=O)NC2=O)c2cccnc21 |
| InChI | InChI=1S/C28H32FN3O3Si/c1-28(2,3)36(4,5)35-17-7-16-32-18-23(21-8-6-15-30-25(21)32)24-22(26(33)31-27(24)34)14-11-19-9-12-20(29)13-10-19/h6,8-15,18H,7,16-17H2,1-5H3,(H,31,33,34)/b14-11+ |
| InChIKey | AJXWUCLDCQAXSV-SDNWHVSQSA-N |
| XLogP | 5.71 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.67 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|