About 2,6-dimethylbenzene-4-id-1-amine;tungsten
2,6-dimethylbenzene-4-id-1-amine;tungsten (PubChem CID 58719800) has the molecular formula C8H10NW6-
and a molecular weight of 1223.21 g/mol. Its IUPAC name is 2,6-dimethylbenzene-4-id-1-amine;tungsten.
Molecular Properties
| Compound Name | 2,6-dimethylbenzene-4-id-1-amine;tungsten |
| PubChem CID | 58719800 |
| Molecular Formula | C8H10NW6- |
| Molecular Weight | 1223.21 g/mol |
| Exact Mass | 1223.79 |
| IUPAC Name | 2,6-dimethylbenzene-4-id-1-amine;tungsten |
| SMILES | Cc1c[c-]cc(C)c1N.[W].[W].[W].[W].[W].[W] |
| InChI | InChI=1S/C8H10N.6W/c1-6-4-3-5-7(2)8(6)9;;;;;;/h4-5H,9H2,1-2H3;;;;;;/q-1;;;;;; |
| InChIKey | BXVDHVGBKDEGAV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 1223.21 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethylbenzene-4-id-1-amine;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethylbenzene-4-id-1-amine;tungsten?
The IUPAC name of 2,6-dimethylbenzene-4-id-1-amine;tungsten (CID 58719800) is 2,6-dimethylbenzene-4-id-1-amine;tungsten.
What is the SMILES notation for 2,6-dimethylbenzene-4-id-1-amine;tungsten?
The canonical SMILES for 2,6-dimethylbenzene-4-id-1-amine;tungsten is Cc1c[c-]cc(C)c1N.[W].[W].[W].[W].[W].[W].
What is the InChIKey of 2,6-dimethylbenzene-4-id-1-amine;tungsten?
The InChIKey is BXVDHVGBKDEGAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N.6W/c1-6-4-3-5-7(2)8(6)9;;;;;;/h4-5H,9H2,1-2H3;;;;;;/q-1;;;;;;.
What are the key properties of 2,6-dimethylbenzene-4-id-1-amine;tungsten?
2,6-dimethylbenzene-4-id-1-amine;tungsten has a molecular weight of 1223.21 g/mol, XLogP of 1.67, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylbenzene-4-id-1-amine;tungsten is sourced from PubChem (CID 58719800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).