About 6-ethoxy-1,4-dimethylpyrimidin-2-one
6-ethoxy-1,4-dimethylpyrimidin-2-one (PubChem CID 58719920) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 6-ethoxy-1,4-dimethylpyrimidin-2-one.
Molecular Properties
| Compound Name | 6-ethoxy-1,4-dimethylpyrimidin-2-one |
| PubChem CID | 58719920 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 6-ethoxy-1,4-dimethylpyrimidin-2-one |
| SMILES | CCOc1cc(C)nc(=O)n1C |
| InChI | InChI=1S/C8H12N2O2/c1-4-12-7-5-6(2)9-8(11)10(7)3/h5H,4H2,1-3H3 |
| InChIKey | PEQBVTHVHFFDNL-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-ethoxy-1,4-dimethylpyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-1,4-dimethylpyrimidin-2-one?
The IUPAC name of 6-ethoxy-1,4-dimethylpyrimidin-2-one (CID 58719920) is 6-ethoxy-1,4-dimethylpyrimidin-2-one.
What is the SMILES notation for 6-ethoxy-1,4-dimethylpyrimidin-2-one?
The canonical SMILES for 6-ethoxy-1,4-dimethylpyrimidin-2-one is CCOc1cc(C)nc(=O)n1C.
What is the InChIKey of 6-ethoxy-1,4-dimethylpyrimidin-2-one?
The InChIKey is PEQBVTHVHFFDNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-4-12-7-5-6(2)9-8(11)10(7)3/h5H,4H2,1-3H3.
What are the key properties of 6-ethoxy-1,4-dimethylpyrimidin-2-one?
6-ethoxy-1,4-dimethylpyrimidin-2-one has a molecular weight of 168.20 g/mol, XLogP of 0.49, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-1,4-dimethylpyrimidin-2-one is sourced from PubChem (CID 58719920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).