About 5-fluoro-2-methyl-1,4,5,6-tetrahydropyrimidine
5-fluoro-2-methyl-1,4,5,6-tetrahydropyrimidine (PubChem CID 58719934) has the molecular formula C5H9FN2
and a molecular weight of 116.14 g/mol. Its IUPAC name is 5-fluoro-2-methyl-1,4,5,6-tetrahydropyrimidine.
Analyze 5-fluoro-2-methyl-1,4,5,6-tetrahydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-methyl-1,4,5,6-tetrahydropyrimidine?
The IUPAC name of 5-fluoro-2-methyl-1,4,5,6-tetrahydropyrimidine (CID 58719934) is 5-fluoro-2-methyl-1,4,5,6-tetrahydropyrimidine.
What is the SMILES notation for 5-fluoro-2-methyl-1,4,5,6-tetrahydropyrimidine?
The canonical SMILES for 5-fluoro-2-methyl-1,4,5,6-tetrahydropyrimidine is CC1=NCC(F)CN1.
What is the InChIKey of 5-fluoro-2-methyl-1,4,5,6-tetrahydropyrimidine?
The InChIKey is LXEFOKPPQDJGKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9FN2/c1-4-7-2-5(6)3-8-4/h5H,2-3H2,1H3,(H,7,8).
What are the key properties of 5-fluoro-2-methyl-1,4,5,6-tetrahydropyrimidine?
5-fluoro-2-methyl-1,4,5,6-tetrahydropyrimidine has a molecular weight of 116.14 g/mol, XLogP of 0.35, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-methyl-1,4,5,6-tetrahydropyrimidine is sourced from PubChem (CID 58719934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).