About 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]butanoic acid
2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]butanoic acid (PubChem CID 58719976) has the molecular formula C14H23NO5S
and a molecular weight of 317.41 g/mol. Its IUPAC name is 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]butanoic acid.
Molecular Properties
| Compound Name | 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]butanoic acid |
| PubChem CID | 58719976 |
| Molecular Formula | C14H23NO5S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]butanoic acid |
| SMILES | CCC(NS(=O)(=O)CC12CCC(CC1=O)C2(C)C)C(=O)O |
| InChI | InChI=1S/C14H23NO5S/c1-4-10(12(17)18)15-21(19,20)8-14-6-5-9(7-11(14)16)13(14,2)3/h9-10,15H,4-8H2,1-3H3,(H,17,18) |
| InChIKey | XDIJCFNZYFHFRY-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]butanoic acid?
The IUPAC name of 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]butanoic acid (CID 58719976) is 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]butanoic acid.
What is the SMILES notation for 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]butanoic acid?
The canonical SMILES for 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]butanoic acid is CCC(NS(=O)(=O)CC12CCC(CC1=O)C2(C)C)C(=O)O.
What is the InChIKey of 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]butanoic acid?
The InChIKey is XDIJCFNZYFHFRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO5S/c1-4-10(12(17)18)15-21(19,20)8-14-6-5-9(7-11(14)16)13(14,2)3/h9-10,15H,4-8H2,1-3H3,(H,17,18).
What are the key properties of 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]butanoic acid?
2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]butanoic acid has a molecular weight of 317.41 g/mol, XLogP of 1.16, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]butanoic acid is sourced from PubChem (CID 58719976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).