C27H38F3N5O — CID 58720003
1-[3-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]propyl]-3-[(1-methylpyrrolidin-2-yl)methyl]urea (PubChem CID 58720003) has the molecular formula C27H38F3N5O and a molecular weight of 505.63 g/mol. Its IUPAC name is 1-[3-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]propyl]-3-[(1-methylpyrrolidin-2-yl)methyl]urea.
| Compound Name | 1-[3-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]propyl]-3-[(1-methylpyrrolidin-2-yl)methyl]urea |
|---|---|
| PubChem CID | 58720003 |
| Molecular Formula | C27H38F3N5O |
| Molecular Weight | 505.63 g/mol |
| Exact Mass | 505.30 |
| IUPAC Name | 1-[3-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]propyl]-3-[(1-methylpyrrolidin-2-yl)methyl]urea |
| SMILES | C[C@H]1c2c([nH]c3ccc(C(F)(F)F)cc23)C[C@H]2CCN(CCCNC(=O)NCC3CCCN3C)C[C@@H]21 |
| InChI | InChI=1S/C27H38F3N5O/c1-17-22-16-35(11-4-9-31-26(36)32-15-20-5-3-10-34(20)2)12-8-18(22)13-24-25(17)21-14-19(27(28,29)30)6-7-23(21)33-24/h6-7,14,17-18,20,22,33H,3-5,8-13,15-16H2,1-2H3,(H2,31,32,36)/t17-,18-,20?,22-/m1/s1 |
| InChIKey | SXGKURUYAUOERG-JSXJZVKPSA-N |
| XLogP | 4.57 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.63 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|