C27H44N2O7S — CID 58720246
(3S,6R,7S,8S)-11-[(2R,3S)-3-[(E,2S)-2-amino-4-[2-(hydroxymethyl)-1,3-thiazol-4-yl]-3-methylbut-3-enyl]-2-methyloxiran-2-yl]-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxoundecanoic acid (PubChem CID 58720246) has the molecular formula C27H44N2O7S and a molecular weight of 540.72 g/mol. Its IUPAC name is (3S,6R,7S,8S)-11-[(2R,3S)-3-[(E,2S)-2-amino-4-[2-(hydroxymethyl)-1,3-thiazol-4-yl]-3-methylbut-3-enyl]-2-methyloxiran-2-yl]-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxoundecanoic acid.
| Compound Name | (3S,6R,7S,8S)-11-[(2R,3S)-3-[(E,2S)-2-amino-4-[2-(hydroxymethyl)-1,3-thiazol-4-yl]-3-methylbut-3-enyl]-2-methyloxiran-2-yl]-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxoundecanoic acid |
|---|---|
| PubChem CID | 58720246 |
| Molecular Formula | C27H44N2O7S |
| Molecular Weight | 540.72 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | (3S,6R,7S,8S)-11-[(2R,3S)-3-[(E,2S)-2-amino-4-[2-(hydroxymethyl)-1,3-thiazol-4-yl]-3-methylbut-3-enyl]-2-methyloxiran-2-yl]-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxoundecanoic acid |
| SMILES | C/C(=C\c1csc(CO)n1)[C@@H](N)C[C@@H]1O[C@]1(C)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C27H44N2O7S/c1-15(24(34)17(3)25(35)26(4,5)20(31)12-23(32)33)8-7-9-27(6)21(36-27)11-19(28)16(2)10-18-14-37-22(13-30)29-18/h10,14-15,17,19-21,24,30-31,34H,7-9,11-13,28H2,1-6H3,(H,32,33)/b16-10+/t15-,17+,19-,20-,21-,24-,27+/m0/s1 |
| InChIKey | GSYAHPROIVCPMB-RGJAOAFDSA-N |
| XLogP | 3.15 |
| TPSA | 166.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.72 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|