C10H26O6Si5 — CID 58720483
[formyl-methyl-[1-(2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)propyl]silyl]formaldehyde (PubChem CID 58720483) has the molecular formula C10H26O6Si5 and a molecular weight of 382.74 g/mol. Its IUPAC name is [formyl-methyl-[1-(2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)propyl]silyl]formaldehyde.
| Compound Name | [formyl-methyl-[1-(2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)propyl]silyl]formaldehyde |
|---|---|
| PubChem CID | 58720483 |
| Molecular Formula | C10H26O6Si5 |
| Molecular Weight | 382.74 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | [formyl-methyl-[1-(2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)propyl]silyl]formaldehyde |
| SMILES | CCC([Si](C)(C=O)C=O)[Si]1(C)O[SiH](C)O[SiH](C)O[SiH](C)O1 |
| InChI | InChI=1S/C10H26O6Si5/c1-7-10(20(5,8-11)9-12)21(6)15-18(3)13-17(2)14-19(4)16-21/h8-10,17-19H,7H2,1-6H3 |
| InChIKey | MBUFPBNILURPAJ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.74 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|