About ethyl 2-[2-amino-3-(2,4-dichloro-6-methylphenyl)imidazolidin-1-ium-1-yl]acetate
ethyl 2-[2-amino-3-(2,4-dichloro-6-methylphenyl)imidazolidin-1-ium-1-yl]acetate (PubChem CID 58720664) has the molecular formula C14H20Cl2N3O2+
and a molecular weight of 333.24 g/mol. Its IUPAC name is ethyl 2-[2-amino-3-(2,4-dichloro-6-methylphenyl)imidazolidin-1-ium-1-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[2-amino-3-(2,4-dichloro-6-methylphenyl)imidazolidin-1-ium-1-yl]acetate |
| PubChem CID | 58720664 |
| Molecular Formula | C14H20Cl2N3O2+ |
| Molecular Weight | 333.24 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | ethyl 2-[2-amino-3-(2,4-dichloro-6-methylphenyl)imidazolidin-1-ium-1-yl]acetate |
| SMILES | CCOC(=O)C[NH+]1CCN(c2c(C)cc(Cl)cc2Cl)C1N |
| InChI | InChI=1S/C14H19Cl2N3O2/c1-3-21-12(20)8-18-4-5-19(14(18)17)13-9(2)6-10(15)7-11(13)16/h6-7,14H,3-5,8,17H2,1-2H3/p+1 |
| InChIKey | BKPRNQNYKNANTE-UHFFFAOYSA-O |
| XLogP | 0.81 |
| TPSA | 60.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.24 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-[2-amino-3-(2,4-dichloro-6-methylphenyl)imidazolidin-1-ium-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-amino-3-(2,4-dichloro-6-methylphenyl)imidazolidin-1-ium-1-yl]acetate?
The IUPAC name of ethyl 2-[2-amino-3-(2,4-dichloro-6-methylphenyl)imidazolidin-1-ium-1-yl]acetate (CID 58720664) is ethyl 2-[2-amino-3-(2,4-dichloro-6-methylphenyl)imidazolidin-1-ium-1-yl]acetate.
What is the SMILES notation for ethyl 2-[2-amino-3-(2,4-dichloro-6-methylphenyl)imidazolidin-1-ium-1-yl]acetate?
The canonical SMILES for ethyl 2-[2-amino-3-(2,4-dichloro-6-methylphenyl)imidazolidin-1-ium-1-yl]acetate is CCOC(=O)C[NH+]1CCN(c2c(C)cc(Cl)cc2Cl)C1N.
What is the InChIKey of ethyl 2-[2-amino-3-(2,4-dichloro-6-methylphenyl)imidazolidin-1-ium-1-yl]acetate?
The InChIKey is BKPRNQNYKNANTE-UHFFFAOYSA-O. The full InChI is InChI=1S/C14H19Cl2N3O2/c1-3-21-12(20)8-18-4-5-19(14(18)17)13-9(2)6-10(15)7-11(13)16/h6-7,14H,3-5,8,17H2,1-2H3/p+1.
What are the key properties of ethyl 2-[2-amino-3-(2,4-dichloro-6-methylphenyl)imidazolidin-1-ium-1-yl]acetate?
ethyl 2-[2-amino-3-(2,4-dichloro-6-methylphenyl)imidazolidin-1-ium-1-yl]acetate has a molecular weight of 333.24 g/mol, XLogP of 0.81, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-amino-3-(2,4-dichloro-6-methylphenyl)imidazolidin-1-ium-1-yl]acetate is sourced from PubChem (CID 58720664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).