C24H29N5O4 — CID 58720800
N-[2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-2-hydroxyethyl]-3-(2,4-dioxo-5,6,7,8-tetrahydroquinazolin-1-yl)propanamide (PubChem CID 58720800) has the molecular formula C24H29N5O4 and a molecular weight of 451.53 g/mol. Its IUPAC name is N-[2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-2-hydroxyethyl]-3-(2,4-dioxo-5,6,7,8-tetrahydroquinazolin-1-yl)propanamide.
| Compound Name | N-[2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-2-hydroxyethyl]-3-(2,4-dioxo-5,6,7,8-tetrahydroquinazolin-1-yl)propanamide |
|---|---|
| PubChem CID | 58720800 |
| Molecular Formula | C24H29N5O4 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | N-[2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-2-hydroxyethyl]-3-(2,4-dioxo-5,6,7,8-tetrahydroquinazolin-1-yl)propanamide |
| SMILES | Cc1ccc(C)n1-c1ccc(C(O)CNC(=O)CCn2c3c(c(=O)[nH]c2=O)CCCC3)cn1 |
| InChI | InChI=1S/C24H29N5O4/c1-15-7-8-16(2)29(15)21-10-9-17(13-25-21)20(30)14-26-22(31)11-12-28-19-6-4-3-5-18(19)23(32)27-24(28)33/h7-10,13,20,30H,3-6,11-12,14H2,1-2H3,(H,26,31)(H,27,32,33) |
| InChIKey | LRYYQQUXBLDCHP-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|