C17H16FNO3S — CID 58720895
(4S,5R)-4-(fluoromethyl)-5-(4-methylperoxysulfanylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazole (PubChem CID 58720895) has the molecular formula C17H16FNO3S and a molecular weight of 333.38 g/mol. Its IUPAC name is (4S,5R)-4-(fluoromethyl)-5-(4-methylperoxysulfanylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S,5R)-4-(fluoromethyl)-5-(4-methylperoxysulfanylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 58720895 |
| Molecular Formula | C17H16FNO3S |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | (4S,5R)-4-(fluoromethyl)-5-(4-methylperoxysulfanylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazole |
| SMILES | COOSc1ccc([C@H]2OC(c3ccccc3)=N[C@@H]2CF)cc1 |
| InChI | InChI=1S/C17H16FNO3S/c1-20-22-23-14-9-7-12(8-10-14)16-15(11-18)19-17(21-16)13-5-3-2-4-6-13/h2-10,15-16H,11H2,1H3/t15-,16-/m1/s1 |
| InChIKey | JPGLOLXNMNDFCZ-HZPDHXFCSA-N |
| XLogP | 4.13 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|