About (4S)-2,2-dimethyl-4-[(2R)-3-methyl-1-nitrobutan-2-yl]-1,3-dioxolane
(4S)-2,2-dimethyl-4-[(2R)-3-methyl-1-nitrobutan-2-yl]-1,3-dioxolane (PubChem CID 58720969) has the molecular formula C10H19NO4
and a molecular weight of 217.26 g/mol. Its IUPAC name is (4S)-2,2-dimethyl-4-[(2R)-3-methyl-1-nitrobutan-2-yl]-1,3-dioxolane.
Molecular Properties
| Compound Name | (4S)-2,2-dimethyl-4-[(2R)-3-methyl-1-nitrobutan-2-yl]-1,3-dioxolane |
| PubChem CID | 58720969 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | (4S)-2,2-dimethyl-4-[(2R)-3-methyl-1-nitrobutan-2-yl]-1,3-dioxolane |
| SMILES | CC(C)[C@H](C[N+](=O)[O-])[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C10H19NO4/c1-7(2)8(5-11(12)13)9-6-14-10(3,4)15-9/h7-9H,5-6H2,1-4H3/t8-,9+/m0/s1 |
| InChIKey | ZQOHGZOIHANNDX-DTWKUNHWSA-N |
| XLogP | 1.69 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4S)-2,2-dimethyl-4-[(2R)-3-methyl-1-nitrobutan-2-yl]-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2,2-dimethyl-4-[(2R)-3-methyl-1-nitrobutan-2-yl]-1,3-dioxolane?
The IUPAC name of (4S)-2,2-dimethyl-4-[(2R)-3-methyl-1-nitrobutan-2-yl]-1,3-dioxolane (CID 58720969) is (4S)-2,2-dimethyl-4-[(2R)-3-methyl-1-nitrobutan-2-yl]-1,3-dioxolane.
What is the SMILES notation for (4S)-2,2-dimethyl-4-[(2R)-3-methyl-1-nitrobutan-2-yl]-1,3-dioxolane?
The canonical SMILES for (4S)-2,2-dimethyl-4-[(2R)-3-methyl-1-nitrobutan-2-yl]-1,3-dioxolane is CC(C)[C@H](C[N+](=O)[O-])[C@H]1COC(C)(C)O1.
What is the InChIKey of (4S)-2,2-dimethyl-4-[(2R)-3-methyl-1-nitrobutan-2-yl]-1,3-dioxolane?
The InChIKey is ZQOHGZOIHANNDX-DTWKUNHWSA-N. The full InChI is InChI=1S/C10H19NO4/c1-7(2)8(5-11(12)13)9-6-14-10(3,4)15-9/h7-9H,5-6H2,1-4H3/t8-,9+/m0/s1.
What are the key properties of (4S)-2,2-dimethyl-4-[(2R)-3-methyl-1-nitrobutan-2-yl]-1,3-dioxolane?
(4S)-2,2-dimethyl-4-[(2R)-3-methyl-1-nitrobutan-2-yl]-1,3-dioxolane has a molecular weight of 217.26 g/mol, XLogP of 1.69, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2,2-dimethyl-4-[(2R)-3-methyl-1-nitrobutan-2-yl]-1,3-dioxolane is sourced from PubChem (CID 58720969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).