C16H32O2 — CID 58721001
2-(2,4,4,6,6-pentamethylhept-2-enyl)butane-1,4-diol (PubChem CID 58721001) has the molecular formula C16H32O2 and a molecular weight of 256.43 g/mol. Its IUPAC name is 2-(2,4,4,6,6-pentamethylhept-2-enyl)butane-1,4-diol.
| Compound Name | 2-(2,4,4,6,6-pentamethylhept-2-enyl)butane-1,4-diol |
|---|---|
| PubChem CID | 58721001 |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | 2-(2,4,4,6,6-pentamethylhept-2-enyl)butane-1,4-diol |
| SMILES | CC(=CC(C)(C)CC(C)(C)C)CC(CO)CCO |
| InChI | InChI=1S/C16H32O2/c1-13(9-14(11-18)7-8-17)10-16(5,6)12-15(2,3)4/h10,14,17-18H,7-9,11-12H2,1-6H3 |
| InChIKey | UHNJDEXCDZAOEP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|